C12H18O5 — CID 11447867
ethyl (1S,2S,4S,5R,6R)-5-hydroxy-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-4-carboxylate (PubChem CID 11447867) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl (1S,2S,4S,5R,6R)-5-hydroxy-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-4-carboxylate.
| Compound Name | ethyl (1S,2S,4S,5R,6R)-5-hydroxy-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-4-carboxylate |
|---|---|
| PubChem CID | 11447867 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl (1S,2S,4S,5R,6R)-5-hydroxy-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonane-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H]1[C@@H]1OC(C)(C)O[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C12H18O5/c1-4-15-10(14)12-5-6(12)7-8(9(12)13)17-11(2,3)16-7/h6-9,13H,4-5H2,1-3H3/t6-,7+,8+,9+,12+/m1/s1 |
| InChIKey | SQLVYFQVUJKVLY-FJVRFIPSSA-N |
| XLogP | 0.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |