C14H18N2 — CID 114481019
3-methyl-4-[(2-methylpyrrolidin-1-yl)methyl]benzonitrile (PubChem CID 114481019) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-methyl-4-[(2-methylpyrrolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(2-methylpyrrolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 114481019 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-methyl-4-[(2-methylpyrrolidin-1-yl)methyl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1CN1CCCC1C |
| InChI | InChI=1S/C14H18N2/c1-11-8-13(9-15)5-6-14(11)10-16-7-3-4-12(16)2/h5-6,8,12H,3-4,7,10H2,1-2H3 |
| InChIKey | SYZNFWACJYWVLE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |