C15H25NO2 — CID 11448106
tert-butyl (2R,4aS,8aS)-2-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline-1-carboxylate (PubChem CID 11448106) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl (2R,4aS,8aS)-2-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2R,4aS,8aS)-2-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 11448106 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl (2R,4aS,8aS)-2-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline-1-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2CC=CC[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-11-9-10-12-7-5-6-8-13(12)16(11)14(17)18-15(2,3)4/h5-6,11-13H,7-10H2,1-4H3/t11-,12-,13+/m1/s1 |
| InChIKey | BSTZAPSHYSNINW-UPJWGTAASA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|