C11H15N3O4 — CID 11448152
[(2S,3R,5R)-3-ethanimidoyl-5-(3-nitropyrrol-1-yl)oxolan-2-yl]methanol (PubChem CID 11448152) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is [(2S,3R,5R)-3-ethanimidoyl-5-(3-nitropyrrol-1-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,3R,5R)-3-ethanimidoyl-5-(3-nitropyrrol-1-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 11448152 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [(2S,3R,5R)-3-ethanimidoyl-5-(3-nitropyrrol-1-yl)oxolan-2-yl]methanol |
| SMILES | [H]/N=C(\C)[C@H]1C[C@H](n2ccc([N+](=O)[O-])c2)O[C@@H]1CO |
| InChI | InChI=1S/C11H15N3O4/c1-7(12)9-4-11(18-10(9)6-15)13-3-2-8(5-13)14(16)17/h2-3,5,9-12,15H,4,6H2,1H3/b12-7+/t9-,10-,11-/m1/s1 |
| InChIKey | LMJWQROMQBSZFH-ZTIVXFSBSA-N |
| XLogP | 1.33 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|