C15H21N3OS — CID 114481694
1-[(4-carbamothioyl-2-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 114481694) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-[(4-carbamothioyl-2-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-carbamothioyl-2-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 114481694 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[(4-carbamothioyl-2-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C(N)=S)ccc1CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H21N3OS/c1-10-8-12(15(17)20)2-3-13(10)9-18-6-4-11(5-7-18)14(16)19/h2-3,8,11H,4-7,9H2,1H3,(H2,16,19)(H2,17,20) |
| InChIKey | LAXCFZQKYBBCJE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|