C15H20N4S — CID 114481804
3-methyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzenecarbothioamide (PubChem CID 114481804) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-methyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzenecarbothioamide.
| Compound Name | 3-methyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 114481804 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-methyl-4-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1CN(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C15H20N4S/c1-11-6-13(15(16)20)4-5-14(11)10-18(2)8-12-7-17-19(3)9-12/h4-7,9H,8,10H2,1-3H3,(H2,16,20) |
| InChIKey | AGRAGGGFRDZBFL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|