C14H26O2Si — CID 11448196
trimethyl-[2-[[(2R,4S)-2-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane (PubChem CID 11448196) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is trimethyl-[2-[[(2R,4S)-2-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane.
| Compound Name | trimethyl-[2-[[(2R,4S)-2-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 11448196 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | trimethyl-[2-[[(2R,4S)-2-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]prop-2-enyl]silane |
| SMILES | C=C(C[C@H]1CCO[C@@H](/C=C/C)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-6-7-14-15-9-8-13(16-14)10-12(2)11-17(3,4)5/h6-7,13-14H,2,8-11H2,1,3-5H3/b7-6+/t13-,14-/m1/s1 |
| InChIKey | KDCUDCZGWSOTEP-JLVOYYQZSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|