C15H16IN3O — CID 114482726
N'-hydroxy-4-[(2-iodoanilino)methyl]-3-methylbenzenecarboximidamide (PubChem CID 114482726) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is N'-hydroxy-4-[(2-iodoanilino)methyl]-3-methylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[(2-iodoanilino)methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114482726 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N'-hydroxy-4-[(2-iodoanilino)methyl]-3-methylbenzenecarboximidamide |
| SMILES | Cc1cc(/C(N)=N/O)ccc1CNc1ccccc1I |
| InChI | InChI=1S/C15H16IN3O/c1-10-8-11(15(17)19-20)6-7-12(10)9-18-14-5-3-2-4-13(14)16/h2-8,18,20H,9H2,1H3,(H2,17,19) |
| InChIKey | DKZQEIUYUQAUJE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|