About 6-bromo-2-heptyl-3,4-dihydro-2H-pyran
6-bromo-2-heptyl-3,4-dihydro-2H-pyran (PubChem CID 11448363) has the molecular formula C12H21BrO
and a molecular weight of 261.20 g/mol. Its IUPAC name is 6-bromo-2-heptyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-bromo-2-heptyl-3,4-dihydro-2H-pyran |
| PubChem CID | 11448363 |
| Molecular Formula | C12H21BrO |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-bromo-2-heptyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCCCC1CCC=C(Br)O1 |
| InChI | InChI=1S/C12H21BrO/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h10-11H,2-9H2,1H3 |
| InChIKey | WBJYJLLCFGWGFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-heptyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-heptyl-3,4-dihydro-2H-pyran?
The IUPAC name of 6-bromo-2-heptyl-3,4-dihydro-2H-pyran (CID 11448363) is 6-bromo-2-heptyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-bromo-2-heptyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-bromo-2-heptyl-3,4-dihydro-2H-pyran is CCCCCCCC1CCC=C(Br)O1.
What is the InChIKey of 6-bromo-2-heptyl-3,4-dihydro-2H-pyran?
The InChIKey is WBJYJLLCFGWGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BrO/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h10-11H,2-9H2,1H3.
What are the key properties of 6-bromo-2-heptyl-3,4-dihydro-2H-pyran?
6-bromo-2-heptyl-3,4-dihydro-2H-pyran has a molecular weight of 261.20 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-heptyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 11448363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).