C17H26N2O — CID 114483836
4-[(4,4-dimethylcyclohexyl)oxymethyl]-3-methylbenzenecarboximidamide (PubChem CID 114483836) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-[(4,4-dimethylcyclohexyl)oxymethyl]-3-methylbenzenecarboximidamide.
| Compound Name | 4-[(4,4-dimethylcyclohexyl)oxymethyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114483836 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 4-[(4,4-dimethylcyclohexyl)oxymethyl]-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(COC2CCC(C)(C)CC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2O/c1-12-10-13(16(18)19)4-5-14(12)11-20-15-6-8-17(2,3)9-7-15/h4-5,10,15H,6-9,11H2,1-3H3,(H3,18,19) |
| InChIKey | WIQXHLMAKDMZGT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|