C18H17NO — CID 11448431
1-benzyl-2-phenyl-2,3-dihydropyridin-4-one (PubChem CID 11448431) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-benzyl-2-phenyl-2,3-dihydropyridin-4-one.
| Compound Name | 1-benzyl-2-phenyl-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 11448431 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-benzyl-2-phenyl-2,3-dihydropyridin-4-one |
| SMILES | O=C1C=CN(Cc2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C18H17NO/c20-17-11-12-19(14-15-7-3-1-4-8-15)18(13-17)16-9-5-2-6-10-16/h1-12,18H,13-14H2 |
| InChIKey | BHFYWYJDBPMYKC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |