C10H11N5S2 — CID 11448486
N,12-dimethyl-4-methylsulfanyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 11448486) has the molecular formula C10H11N5S2 and a molecular weight of 265.37 g/mol. Its IUPAC name is N,12-dimethyl-4-methylsulfanyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N,12-dimethyl-4-methylsulfanyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 11448486 |
| Molecular Formula | C10H11N5S2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N,12-dimethyl-4-methylsulfanyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(SC)nc2c2c1ncn2C |
| InChI | InChI=1S/C10H11N5S2/c1-11-8-5-7(15(2)4-12-5)6-9(14-8)17-10(13-6)16-3/h4H,1-3H3,(H,11,14) |
| InChIKey | YFOQLWYTRVQHIZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |