About [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate
[2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate (PubChem CID 11448565) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate.
Molecular Properties
| Compound Name | [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate |
| PubChem CID | 11448565 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)OC(C)C1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C15H24O4/c1-5-13(16)18-10-14(17)19-11(2)12-7-6-8-15(3,4)9-12/h7,11H,5-6,8-10H2,1-4H3 |
| InChIKey | SRUPPQFPPATPSM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate?
The IUPAC name of [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate (CID 11448565) is [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate.
What is the SMILES notation for [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate?
The canonical SMILES for [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate is CCC(=O)OCC(=O)OC(C)C1=CCCC(C)(C)C1.
What is the InChIKey of [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate?
The InChIKey is SRUPPQFPPATPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-5-13(16)18-10-14(17)19-11(2)12-7-6-8-15(3,4)9-12/h7,11H,5-6,8-10H2,1-4H3.
What are the key properties of [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate?
[2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate has a molecular weight of 268.35 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(5,5-dimethylcyclohexen-1-yl)ethoxy]-2-oxoethyl] propanoate is sourced from PubChem (CID 11448565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).