C17H18O3 — CID 11448602
(2Z,4E)-5-(2,2-dimethylchromen-3-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 11448602) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2Z,4E)-5-(2,2-dimethylchromen-3-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(2,2-dimethylchromen-3-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 11448602 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2Z,4E)-5-(2,2-dimethylchromen-3-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/C1=Cc2ccccc2OC1(C)C |
| InChI | InChI=1S/C17H18O3/c1-12(10-16(18)19)8-9-14-11-13-6-4-5-7-15(13)20-17(14,2)3/h4-11H,1-3H3,(H,18,19)/b9-8+,12-10- |
| InChIKey | HQNACJPTYLCSFG-ZLNDROGTSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|