C14H14N4S — CID 11448608
11,13-dimethyl-12-prop-2-enyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 11448608) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 11,13-dimethyl-12-prop-2-enyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11,13-dimethyl-12-prop-2-enyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 11448608 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 11,13-dimethyl-12-prop-2-enyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | C=CCc1c(C)nc2sc3c(N)ncnc3c2c1C |
| InChI | InChI=1S/C14H14N4S/c1-4-5-9-7(2)10-11-12(13(15)17-6-16-11)19-14(10)18-8(9)3/h4,6H,1,5H2,2-3H3,(H2,15,16,17) |
| InChIKey | FZSWHGABTFOPJB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|