About 12-methyltetradecyl acetate
12-methyltetradecyl acetate (PubChem CID 11448616) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 12-methyltetradecyl acetate.
Molecular Properties
| Compound Name | 12-methyltetradecyl acetate |
| PubChem CID | 11448616 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 12-methyltetradecyl acetate |
| SMILES | CCC(C)CCCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C17H34O2/c1-4-16(2)14-12-10-8-6-5-7-9-11-13-15-19-17(3)18/h16H,4-15H2,1-3H3 |
| InChIKey | SFSSSWKTUWDGQW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-methyltetradecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyltetradecyl acetate?
The IUPAC name of 12-methyltetradecyl acetate (CID 11448616) is 12-methyltetradecyl acetate.
What is the SMILES notation for 12-methyltetradecyl acetate?
The canonical SMILES for 12-methyltetradecyl acetate is CCC(C)CCCCCCCCCCCOC(C)=O.
What is the InChIKey of 12-methyltetradecyl acetate?
The InChIKey is SFSSSWKTUWDGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-4-16(2)14-12-10-8-6-5-7-9-11-13-15-19-17(3)18/h16H,4-15H2,1-3H3.
What are the key properties of 12-methyltetradecyl acetate?
12-methyltetradecyl acetate has a molecular weight of 270.46 g/mol, XLogP of 5.50, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyltetradecyl acetate is sourced from PubChem (CID 11448616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).