C19H28O — CID 11448681
(1S,2'S,4R,4'S,5R,7R)-2',4'-bis(ethenyl)-5,8,8-trimethylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one (PubChem CID 11448681) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1S,2'S,4R,4'S,5R,7R)-2',4'-bis(ethenyl)-5,8,8-trimethylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one.
| Compound Name | (1S,2'S,4R,4'S,5R,7R)-2',4'-bis(ethenyl)-5,8,8-trimethylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 11448681 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1S,2'S,4R,4'S,5R,7R)-2',4'-bis(ethenyl)-5,8,8-trimethylspiro[bicyclo[5.1.0]octane-4,1'-cyclopentane]-3-one |
| SMILES | C=C[C@H]1C[C@@H](C=C)[C@]2(C1)C(=O)C[C@H]1[C@@H](C[C@H]2C)C1(C)C |
| InChI | InChI=1S/C19H28O/c1-6-13-9-14(7-2)19(11-13)12(3)8-15-16(10-17(19)20)18(15,4)5/h6-7,12-16H,1-2,8-11H2,3-5H3/t12-,13+,14-,15-,16+,19-/m1/s1 |
| InChIKey | GQHDYHDBVASXBY-XPYFFNBCSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|