About trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane
trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane (PubChem CID 11448725) has the molecular formula C13H17F3OSi
and a molecular weight of 274.36 g/mol. Its IUPAC name is trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane |
| PubChem CID | 11448725 |
| Molecular Formula | C13H17F3OSi |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane |
| SMILES | C[Si](C)(C)OC(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H17F3OSi/c1-18(2,3)17-12(13(14,15)16)10-9-11-7-5-4-6-8-11/h4-10,12H,1-3H3/b10-9+ |
| InChIKey | KSDAUMCFDAWBKO-MDZDMXLPSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane?
The IUPAC name of trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane (CID 11448725) is trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane.
What is the SMILES notation for trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane?
The canonical SMILES for trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane is C[Si](C)(C)OC(/C=C/c1ccccc1)C(F)(F)F.
What is the InChIKey of trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane?
The InChIKey is KSDAUMCFDAWBKO-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H17F3OSi/c1-18(2,3)17-12(13(14,15)16)10-9-11-7-5-4-6-8-11/h4-10,12H,1-3H3/b10-9+.
What are the key properties of trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane?
trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane has a molecular weight of 274.36 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]oxysilane is sourced from PubChem (CID 11448725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).