C19H21NO — CID 11448843
9-methyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 11448843) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 9-methyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 9-methyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 11448843 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 9-methyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cc1ccc2c(c1)C1OCCCC1C(c1ccccc1)N2 |
| InChI | InChI=1S/C19H21NO/c1-13-9-10-17-16(12-13)19-15(8-5-11-21-19)18(20-17)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,15,18-20H,5,8,11H2,1H3 |
| InChIKey | KMWMLXYKAILFAQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |