C9H8ClFN4 — CID 114488623
4-(3-chloro-2-fluorophenyl)imidazole-1,5-diamine (PubChem CID 114488623) has the molecular formula C9H8ClFN4 and a molecular weight of 226.64 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)imidazole-1,5-diamine.
| Compound Name | 4-(3-chloro-2-fluorophenyl)imidazole-1,5-diamine |
|---|---|
| PubChem CID | 114488623 |
| Molecular Formula | C9H8ClFN4 |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)imidazole-1,5-diamine |
| SMILES | Nc1c(-c2cccc(Cl)c2F)ncn1N |
| InChI | InChI=1S/C9H8ClFN4/c10-6-3-1-2-5(7(6)11)8-9(12)15(13)4-14-8/h1-4H,12-13H2 |
| InChIKey | CQECHQRFMUEXAA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |