C14H18BrF3N2S — CID 114489612
1-(4-bromothiophen-2-yl)-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine (PubChem CID 114489612) has the molecular formula C14H18BrF3N2S and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine |
|---|---|
| PubChem CID | 114489612 |
| Molecular Formula | C14H18BrF3N2S |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-2-amine |
| SMILES | CCC(N)C(c1cc(Br)cs1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18BrF3N2S/c1-2-11(19)13(12-7-10(15)8-21-12)20-5-3-9(4-6-20)14(16,17)18/h3,7-8,11,13H,2,4-6,19H2,1H3 |
| InChIKey | MLARYPCLKWVIQV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|