C14H23F3N2 — CID 114490127
1-[(3-ethylpiperidin-3-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 114490127) has the molecular formula C14H23F3N2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 1-[(3-ethylpiperidin-3-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(3-ethylpiperidin-3-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114490127 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[(3-ethylpiperidin-3-yl)methyl]-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | CCC1(CN2CC=C(C(F)(F)F)CC2)CCCNC1 |
| InChI | InChI=1S/C14H23F3N2/c1-2-13(6-3-7-18-10-13)11-19-8-4-12(5-9-19)14(15,16)17/h4,18H,2-3,5-11H2,1H3 |
| InChIKey | BCOVLOPMSNYGRN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|