C12H21F3N2 — CID 114490160
3-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentan-3-amine (PubChem CID 114490160) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentan-3-amine.
| Compound Name | 3-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentan-3-amine |
|---|---|
| PubChem CID | 114490160 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentan-3-amine |
| SMILES | CCC(N)(CC)CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2/c1-3-11(16,4-2)9-17-7-5-10(6-8-17)12(13,14)15/h5H,3-4,6-9,16H2,1-2H3 |
| InChIKey | ZYHKMDHVZJTGPT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|