C10H10ClF3N2OS — CID 114490327
[4-chloro-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-1,3-thiazol-5-yl]methanol (PubChem CID 114490327) has the molecular formula C10H10ClF3N2OS and a molecular weight of 298.72 g/mol. Its IUPAC name is [4-chloro-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-chloro-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 114490327 |
| Molecular Formula | C10H10ClF3N2OS |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | [4-chloro-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1sc(N2CC=C(C(F)(F)F)CC2)nc1Cl |
| InChI | InChI=1S/C10H10ClF3N2OS/c11-8-7(5-17)18-9(15-8)16-3-1-6(2-4-16)10(12,13)14/h1,17H,2-5H2 |
| InChIKey | XHEWZSNGYRDUSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|