C11H13F3N4O — CID 114490503
(5-ethyl-1H-1,2,4-triazol-3-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 114490503) has the molecular formula C11H13F3N4O and a molecular weight of 274.25 g/mol. Its IUPAC name is (5-ethyl-1H-1,2,4-triazol-3-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (5-ethyl-1H-1,2,4-triazol-3-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 114490503 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (5-ethyl-1H-1,2,4-triazol-3-yl)-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | CCc1nc(C(=O)N2CC=C(C(F)(F)F)CC2)n[nH]1 |
| InChI | InChI=1S/C11H13F3N4O/c1-2-8-15-9(17-16-8)10(19)18-5-3-7(4-6-18)11(12,13)14/h3H,2,4-6H2,1H3,(H,15,16,17) |
| InChIKey | CVBXKKAZXDFQNU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|