About tributyl(methyl)azanium tetrafluoroborate
tributyl(methyl)azanium tetrafluoroborate (PubChem CID 11449059) has the molecular formula C13H30BF4N
and a molecular weight of 287.19 g/mol. Its IUPAC name is tributyl(methyl)azanium tetrafluoroborate.
Molecular Properties
| Compound Name | tributyl(methyl)azanium tetrafluoroborate |
| PubChem CID | 11449059 |
| Molecular Formula | C13H30BF4N |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | tributyl(methyl)azanium tetrafluoroborate |
| SMILES | CCCC[N+](C)(CCCC)CCCC.F[B-](F)(F)F |
| InChI | InChI=1S/C13H30N.BF4/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1(3,4)5/h5-13H2,1-4H3;/q+1;-1 |
| InChIKey | QZLWACNYEXKXKP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tributyl(methyl)azanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(methyl)azanium tetrafluoroborate?
The IUPAC name of tributyl(methyl)azanium tetrafluoroborate (CID 11449059) is tributyl(methyl)azanium tetrafluoroborate.
What is the SMILES notation for tributyl(methyl)azanium tetrafluoroborate?
The canonical SMILES for tributyl(methyl)azanium tetrafluoroborate is CCCC[N+](C)(CCCC)CCCC.F[B-](F)(F)F.
What is the InChIKey of tributyl(methyl)azanium tetrafluoroborate?
The InChIKey is QZLWACNYEXKXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N.BF4/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1(3,4)5/h5-13H2,1-4H3;/q+1;-1.
What are the key properties of tributyl(methyl)azanium tetrafluoroborate?
tributyl(methyl)azanium tetrafluoroborate has a molecular weight of 287.19 g/mol, XLogP of 5.13, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(methyl)azanium tetrafluoroborate is sourced from PubChem (CID 11449059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).