About 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one
5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one (PubChem CID 11449070) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one |
| PubChem CID | 11449070 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2c(-c3ccccc3)nn3ccccc23)c[nH]1 |
| InChI | InChI=1S/C18H13N3O/c22-16-10-9-14(12-19-16)17-15-8-4-5-11-21(15)20-18(17)13-6-2-1-3-7-13/h1-12H,(H,19,22) |
| InChIKey | NBXJVMHXOPVEPU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one?
The IUPAC name of 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one (CID 11449070) is 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one.
What is the SMILES notation for 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one?
The canonical SMILES for 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one is O=c1ccc(-c2c(-c3ccccc3)nn3ccccc23)c[nH]1.
What is the InChIKey of 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one?
The InChIKey is NBXJVMHXOPVEPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c22-16-10-9-14(12-19-16)17-15-8-4-5-11-21(15)20-18(17)13-6-2-1-3-7-13/h1-12H,(H,19,22).
What are the key properties of 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one?
5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one has a molecular weight of 287.32 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyridin-2-one is sourced from PubChem (CID 11449070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).