C12H20F3N3O2S — CID 114491031
[1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidin-4-yl]methanamine (PubChem CID 114491031) has the molecular formula C12H20F3N3O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is [1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidin-4-yl]methanamine.
| Compound Name | [1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 114491031 |
| Molecular Formula | C12H20F3N3O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperidin-4-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)N2CC=C(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C12H20F3N3O2S/c13-12(14,15)11-3-7-18(8-4-11)21(19,20)17-5-1-10(9-16)2-6-17/h3,10H,1-2,4-9,16H2 |
| InChIKey | ILUSUOMFUYNLOE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|