C17H25NO3 — CID 11449203
methyl (1S,7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylate (PubChem CID 11449203) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl (1S,7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylate.
| Compound Name | methyl (1S,7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylate |
|---|---|
| PubChem CID | 11449203 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl (1S,7S,8R,10S,12S,14S)-8-hydroxy-14-methyl-3-azatetracyclo[9.3.1.03,12.07,12]pentadec-11(15)-ene-10-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](O)[C@H]2CCCN3C[C@@H]4C=C1[C@]23C[C@@H]4C |
| InChI | InChI=1S/C17H25NO3/c1-10-8-17-13-4-3-5-18(17)9-11(10)6-14(17)12(7-15(13)19)16(20)21-2/h6,10-13,15,19H,3-5,7-9H2,1-2H3/t10-,11-,12-,13+,15+,17-/m0/s1 |
| InChIKey | SUIJBINIABYIQD-KJAWFAQXSA-N |
| XLogP | 1.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|