C13H18ClNO — CID 114494662
6-chloro-2,2-diethyl-8-methyl-3,4-dihydro-1,4-benzoxazine (PubChem CID 114494662) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 6-chloro-2,2-diethyl-8-methyl-3,4-dihydro-1,4-benzoxazine.
| Compound Name | 6-chloro-2,2-diethyl-8-methyl-3,4-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 114494662 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 6-chloro-2,2-diethyl-8-methyl-3,4-dihydro-1,4-benzoxazine |
| SMILES | CCC1(CC)CNc2cc(Cl)cc(C)c2O1 |
| InChI | InChI=1S/C13H18ClNO/c1-4-13(5-2)8-15-11-7-10(14)6-9(3)12(11)16-13/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | UGZJCOPXOADSBS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |