About [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate
[2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate (PubChem CID 11449510) has the molecular formula C12H22N4O3S
and a molecular weight of 302.40 g/mol. Its IUPAC name is [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate |
| PubChem CID | 11449510 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate |
| SMILES | CCCc1c(C)nc(NCC)nc1OS(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H22N4O3S/c1-6-8-10-9(3)14-12(13-7-2)15-11(10)19-20(17,18)16(4)5/h6-8H2,1-5H3,(H,13,14,15) |
| InChIKey | VDONXOWYVDWCFM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate?
The IUPAC name of [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate (CID 11449510) is [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate.
What is the SMILES notation for [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate?
The canonical SMILES for [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate is CCCc1c(C)nc(NCC)nc1OS(=O)(=O)N(C)C.
What is the InChIKey of [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate?
The InChIKey is VDONXOWYVDWCFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O3S/c1-6-8-10-9(3)14-12(13-7-2)15-11(10)19-20(17,18)16(4)5/h6-8H2,1-5H3,(H,13,14,15).
What are the key properties of [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate?
[2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate has a molecular weight of 302.40 g/mol, XLogP of 1.35, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethylamino)-6-methyl-5-propylpyrimidin-4-yl] N,N-dimethylsulfamate is sourced from PubChem (CID 11449510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).