C14H25NO6 — CID 11449530
tert-butyl (4aS,7R,8R,8aR)-7,8-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 11449530) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl (4aS,7R,8R,8aR)-7,8-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4aS,7R,8R,8aR)-7,8-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 11449530 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl (4aS,7R,8R,8aR)-7,8-dihydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)[C@@H](O)[C@@H]2OC(C)(C)OC[C@@H]21 |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)21-12(18)15-6-9(16)10(17)11-8(15)7-19-14(4,5)20-11/h8-11,16-17H,6-7H2,1-5H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | UCLPJFJJJXHMRO-LNFKQOIKSA-N |
| XLogP | 0.48 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |