About 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol
3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol (PubChem CID 114495612) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol |
| PubChem CID | 114495612 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CN1CCC(CC)(CC)CC1 |
| InChI | InChI=1S/C15H31NO/c1-5-14(6-2)9-11-16(12-10-14)13-15(17,7-3)8-4/h17H,5-13H2,1-4H3 |
| InChIKey | FUMLFQXSLICLSB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol?
The IUPAC name of 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol (CID 114495612) is 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol.
What is the SMILES notation for 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol?
The canonical SMILES for 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol is CCC(O)(CC)CN1CCC(CC)(CC)CC1.
What is the InChIKey of 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol?
The InChIKey is FUMLFQXSLICLSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-5-14(6-2)9-11-16(12-10-14)13-15(17,7-3)8-4/h17H,5-13H2,1-4H3.
What are the key properties of 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol?
3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol has a molecular weight of 241.42 g/mol, XLogP of 3.44, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-diethylpiperidin-1-yl)methyl]pentan-3-ol is sourced from PubChem (CID 114495612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).