C13H28N2O — CID 114495626
2-methyl-1-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]butan-2-ol (PubChem CID 114495626) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-methyl-1-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]butan-2-ol.
| Compound Name | 2-methyl-1-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 114495626 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 2-methyl-1-[methyl-[(1-methylpiperidin-4-yl)methyl]amino]butan-2-ol |
| SMILES | CCC(C)(O)CN(C)CC1CCN(C)CC1 |
| InChI | InChI=1S/C13H28N2O/c1-5-13(2,16)11-15(4)10-12-6-8-14(3)9-7-12/h12,16H,5-11H2,1-4H3 |
| InChIKey | BLPNQMCTNPDQER-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |