About 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid
4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid (PubChem CID 11449569) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid |
| PubChem CID | 11449569 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid |
| SMILES | CCCN(CCCC(=O)O)CCc1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C17H24N2O3/c1-2-9-19(10-4-7-17(21)22)11-8-13-5-3-6-15-14(13)12-16(20)18-15/h3,5-6H,2,4,7-12H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | SEBBLUKIRMJZLG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid?
The IUPAC name of 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid (CID 11449569) is 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid.
What is the SMILES notation for 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid?
The canonical SMILES for 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid is CCCN(CCCC(=O)O)CCc1cccc2c1CC(=O)N2.
What is the InChIKey of 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid?
The InChIKey is SEBBLUKIRMJZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-2-9-19(10-4-7-17(21)22)11-8-13-5-3-6-15-14(13)12-16(20)18-15/h3,5-6H,2,4,7-12H2,1H3,(H,18,20)(H,21,22).
What are the key properties of 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid?
4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid has a molecular weight of 304.39 g/mol, XLogP of 2.30, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-oxo-1,3-dihydroindol-4-yl)ethyl-propylamino]butanoic acid is sourced from PubChem (CID 11449569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).