About 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol
3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol (PubChem CID 114496646) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol |
| PubChem CID | 114496646 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CN1c2ccccc2NCC1C |
| InChI | InChI=1S/C15H24N2O/c1-4-15(18,5-2)11-17-12(3)10-16-13-8-6-7-9-14(13)17/h6-9,12,16,18H,4-5,10-11H2,1-3H3 |
| InChIKey | OUHYWTRTRANMPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol?
The IUPAC name of 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol (CID 114496646) is 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol.
What is the SMILES notation for 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol?
The canonical SMILES for 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol is CCC(O)(CC)CN1c2ccccc2NCC1C.
What is the InChIKey of 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol?
The InChIKey is OUHYWTRTRANMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-4-15(18,5-2)11-17-12(3)10-16-13-8-6-7-9-14(13)17/h6-9,12,16,18H,4-5,10-11H2,1-3H3.
What are the key properties of 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol?
3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol has a molecular weight of 248.37 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-3,4-dihydro-2H-quinoxalin-1-yl)methyl]pentan-3-ol is sourced from PubChem (CID 114496646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).