About methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate
methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate (PubChem CID 11449703) has the molecular formula C18H32O2Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate.
Molecular Properties
| Compound Name | methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate |
| PubChem CID | 11449703 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate |
| SMILES | COC(=O)CC/C=C/C/C(=C/[Si](C)(C)C)CC1CCCC1 |
| InChI | InChI=1S/C18H32O2Si/c1-20-18(19)13-7-5-6-12-17(15-21(2,3)4)14-16-10-8-9-11-16/h5-6,15-16H,7-14H2,1-4H3/b6-5+,17-15- |
| InChIKey | YYTNKPULWNSFQX-PEJUDWPJSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate?
The IUPAC name of methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate (CID 11449703) is methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate.
What is the SMILES notation for methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate?
The canonical SMILES for methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate is COC(=O)CC/C=C/C/C(=C/[Si](C)(C)C)CC1CCCC1.
What is the InChIKey of methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate?
The InChIKey is YYTNKPULWNSFQX-PEJUDWPJSA-N. The full InChI is InChI=1S/C18H32O2Si/c1-20-18(19)13-7-5-6-12-17(15-21(2,3)4)14-16-10-8-9-11-16/h5-6,15-16H,7-14H2,1-4H3/b6-5+,17-15-.
What are the key properties of methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate?
methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate has a molecular weight of 308.54 g/mol, XLogP of 5.27, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4E,7E)-7-(cyclopentylmethyl)-8-trimethylsilylocta-4,7-dienoate is sourced from PubChem (CID 11449703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).