About 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine]
5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] (PubChem CID 114497585) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine].
Molecular Properties
| Compound Name | 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] |
| PubChem CID | 114497585 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] |
| SMILES | COc1ccc2c(c1)C1(CC2)CNCC(C)(C(C)C)O1 |
| InChI | InChI=1S/C17H25NO2/c1-12(2)16(3)10-18-11-17(20-16)8-7-13-5-6-14(19-4)9-15(13)17/h5-6,9,12,18H,7-8,10-11H2,1-4H3 |
| InChIKey | CIQSVQQVDIAHSD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine]?
The IUPAC name of 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] (CID 114497585) is 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine].
What is the SMILES notation for 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine]?
The canonical SMILES for 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] is COc1ccc2c(c1)C1(CC2)CNCC(C)(C(C)C)O1.
What is the InChIKey of 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine]?
The InChIKey is CIQSVQQVDIAHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-12(2)16(3)10-18-11-17(20-16)8-7-13-5-6-14(19-4)9-15(13)17/h5-6,9,12,18H,7-8,10-11H2,1-4H3.
What are the key properties of 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine]?
5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] has a molecular weight of 275.39 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6'-methyl-6'-propan-2-ylspiro[1,2-dihydroindene-3,2'-morpholine] is sourced from PubChem (CID 114497585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).