C21H30O2 — CID 11449856
(4aR,4bS,6aS,7S,10aS,10bR)-6a-ethyl-7-hydroxy-4a-methyl-4,4b,5,6,7,8,10a,10b,11,12-decahydro-3H-chrysen-2-one (PubChem CID 11449856) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4aR,4bS,6aS,7S,10aS,10bR)-6a-ethyl-7-hydroxy-4a-methyl-4,4b,5,6,7,8,10a,10b,11,12-decahydro-3H-chrysen-2-one.
| Compound Name | (4aR,4bS,6aS,7S,10aS,10bR)-6a-ethyl-7-hydroxy-4a-methyl-4,4b,5,6,7,8,10a,10b,11,12-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 11449856 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4aR,4bS,6aS,7S,10aS,10bR)-6a-ethyl-7-hydroxy-4a-methyl-4,4b,5,6,7,8,10a,10b,11,12-decahydro-3H-chrysen-2-one |
| SMILES | CC[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1C=CC[C@@H]2O |
| InChI | InChI=1S/C21H30O2/c1-3-21-12-10-17-16(18(21)5-4-6-19(21)23)8-7-14-13-15(22)9-11-20(14,17)2/h4-5,13,16-19,23H,3,6-12H2,1-2H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | HKTAWQXTYCGCCZ-CEGNMAFCSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|