C8H13N3O2 — CID 114499550
6-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 114499550) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 6-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 114499550 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 6-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CNCCC12NC(=O)NC2=O |
| InChI | InChI=1S/C8H13N3O2/c1-5-4-9-3-2-8(5)6(12)10-7(13)11-8/h5,9H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | PPCFBKPXCSUWEC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|