C14H20FN3O — CID 114499616
4-(3-fluoro-5-methylanilino)-3-methylpiperidine-4-carboxamide (PubChem CID 114499616) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(3-fluoro-5-methylanilino)-3-methylpiperidine-4-carboxamide.
| Compound Name | 4-(3-fluoro-5-methylanilino)-3-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 114499616 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-(3-fluoro-5-methylanilino)-3-methylpiperidine-4-carboxamide |
| SMILES | Cc1cc(F)cc(NC2(C(N)=O)CCNCC2C)c1 |
| InChI | InChI=1S/C14H20FN3O/c1-9-5-11(15)7-12(6-9)18-14(13(16)19)3-4-17-8-10(14)2/h5-7,10,17-18H,3-4,8H2,1-2H3,(H2,16,19) |
| InChIKey | LCRCEZXTGKBHQO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |