C9H17N3O2 — CID 114501145
2-amino-3-(3-methyl-4-oxopiperidin-1-yl)propanamide (PubChem CID 114501145) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-amino-3-(3-methyl-4-oxopiperidin-1-yl)propanamide.
| Compound Name | 2-amino-3-(3-methyl-4-oxopiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 114501145 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-amino-3-(3-methyl-4-oxopiperidin-1-yl)propanamide |
| SMILES | CC1CN(CC(N)C(N)=O)CCC1=O |
| InChI | InChI=1S/C9H17N3O2/c1-6-4-12(3-2-8(6)13)5-7(10)9(11)14/h6-7H,2-5,10H2,1H3,(H2,11,14) |
| InChIKey | MXPQZLCQTBLHRQ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |