About 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid
5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 114503116) has the molecular formula C11H17N3O4S2
and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 114503116 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1CN(C)CCC1NS(=O)(=O)c1scnc1C(=O)O |
| InChI | InChI=1S/C11H17N3O4S2/c1-7-5-14(2)4-3-8(7)13-20(17,18)11-9(10(15)16)12-6-19-11/h6-8,13H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | HQXJZOYIAARINQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid (CID 114503116) is 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid is CC1CN(C)CCC1NS(=O)(=O)c1scnc1C(=O)O.
What is the InChIKey of 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is HQXJZOYIAARINQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4S2/c1-7-5-14(2)4-3-8(7)13-20(17,18)11-9(10(15)16)12-6-19-11/h6-8,13H,3-5H2,1-2H3,(H,15,16).
What are the key properties of 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid?
5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 319.41 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 114503116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).