C15H18F3NO4 — CID 11450415
methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoate (PubChem CID 11450415) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoate.
| Compound Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 11450415 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,4,5-trifluorophenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1cc(F)c(F)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H18F3NO4/c1-15(2,3)23-14(21)19-12(13(20)22-4)6-8-5-10(17)11(18)7-9(8)16/h5,7,12H,6H2,1-4H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | GHYSWEVKQJYCJQ-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|