C14H24INO — CID 114504183
N-(3-iodopropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide (PubChem CID 114504183) has the molecular formula C14H24INO and a molecular weight of 349.26 g/mol. Its IUPAC name is N-(3-iodopropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide.
| Compound Name | N-(3-iodopropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 114504183 |
| Molecular Formula | C14H24INO |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(3-iodopropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
| SMILES | O=C(NCCCI)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H24INO/c15-8-3-9-16-14(17)13-7-6-11-4-1-2-5-12(11)10-13/h11-13H,1-10H2,(H,16,17) |
| InChIKey | AGZMSLOFUYUWKF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|