C16H21ClFN3 — CID 114505156
2-(1-chloroethyl)-1-(1,3-dimethylpiperidin-4-yl)-6-fluorobenzimidazole (PubChem CID 114505156) has the molecular formula C16H21ClFN3 and a molecular weight of 309.82 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(1,3-dimethylpiperidin-4-yl)-6-fluorobenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(1,3-dimethylpiperidin-4-yl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 114505156 |
| Molecular Formula | C16H21ClFN3 |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(1-chloroethyl)-1-(1,3-dimethylpiperidin-4-yl)-6-fluorobenzimidazole |
| SMILES | CC(Cl)c1nc2ccc(F)cc2n1C1CCN(C)CC1C |
| InChI | InChI=1S/C16H21ClFN3/c1-10-9-20(3)7-6-14(10)21-15-8-12(18)4-5-13(15)19-16(21)11(2)17/h4-5,8,10-11,14H,6-7,9H2,1-3H3 |
| InChIKey | NXIYRPGCPPEPOH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|