C14H28N2O3S — CID 114507103
N,3-diethyl-1-(oxan-4-ylsulfonyl)piperidin-4-amine (PubChem CID 114507103) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is N,3-diethyl-1-(oxan-4-ylsulfonyl)piperidin-4-amine.
| Compound Name | N,3-diethyl-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 114507103 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N,3-diethyl-1-(oxan-4-ylsulfonyl)piperidin-4-amine |
| SMILES | CCNC1CCN(S(=O)(=O)C2CCOCC2)CC1CC |
| InChI | InChI=1S/C14H28N2O3S/c1-3-12-11-16(8-5-14(12)15-4-2)20(17,18)13-6-9-19-10-7-13/h12-15H,3-11H2,1-2H3 |
| InChIKey | GJJSOSVWDJYECF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |