C12H16BrNO3S2 — CID 114508506
1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-3-ethylpiperidin-4-one (PubChem CID 114508506) has the molecular formula C12H16BrNO3S2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-3-ethylpiperidin-4-one.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-3-ethylpiperidin-4-one |
|---|---|
| PubChem CID | 114508506 |
| Molecular Formula | C12H16BrNO3S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-3-ethylpiperidin-4-one |
| SMILES | CCC1CN(S(=O)(=O)c2cc(C)c(Br)s2)CCC1=O |
| InChI | InChI=1S/C12H16BrNO3S2/c1-3-9-7-14(5-4-10(9)15)19(16,17)11-6-8(2)12(13)18-11/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | HRWJZLNHHAPGOK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |