About [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate (PubChem CID 11450946) has the molecular formula C21H18O5
and a molecular weight of 350.37 g/mol. Its IUPAC name is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate.
Molecular Properties
| Compound Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate |
| PubChem CID | 11450946 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate |
| SMILES | CC(COC(=O)c1ccccc1)CC1=C(O)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C21H18O5/c1-13(12-26-21(25)14-7-3-2-4-8-14)11-17-18(22)15-9-5-6-10-16(15)19(23)20(17)24/h2-10,13,22H,11-12H2,1H3 |
| InChIKey | ZCXQTQUYKALXDH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate?
The IUPAC name of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate (CID 11450946) is [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate.
What is the SMILES notation for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate?
The canonical SMILES for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate is CC(COC(=O)c1ccccc1)CC1=C(O)c2ccccc2C(=O)C1=O.
What is the InChIKey of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate?
The InChIKey is ZCXQTQUYKALXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O5/c1-13(12-26-21(25)14-7-3-2-4-8-14)11-17-18(22)15-9-5-6-10-16(15)19(23)20(17)24/h2-10,13,22H,11-12H2,1H3.
What are the key properties of [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate?
[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate has a molecular weight of 350.37 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-2-methylpropyl] benzoate is sourced from PubChem (CID 11450946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).