C21H34O4 — CID 11450961
methyl (4S,5S,6R)-4-methoxy-6-[(E)-oct-1-enyl]-10-oxospiro[4.5]decane-9-carboxylate (PubChem CID 11450961) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (4S,5S,6R)-4-methoxy-6-[(E)-oct-1-enyl]-10-oxospiro[4.5]decane-9-carboxylate.
| Compound Name | methyl (4S,5S,6R)-4-methoxy-6-[(E)-oct-1-enyl]-10-oxospiro[4.5]decane-9-carboxylate |
|---|---|
| PubChem CID | 11450961 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (4S,5S,6R)-4-methoxy-6-[(E)-oct-1-enyl]-10-oxospiro[4.5]decane-9-carboxylate |
| SMILES | CCCCCC/C=C/[C@H]1CCC(C(=O)OC)C(=O)[C@@]12CCC[C@@H]2OC |
| InChI | InChI=1S/C21H34O4/c1-4-5-6-7-8-9-11-16-13-14-17(20(23)25-3)19(22)21(16)15-10-12-18(21)24-2/h9,11,16-18H,4-8,10,12-15H2,1-3H3/b11-9+/t16-,17?,18-,21-/m0/s1 |
| InChIKey | IUFDDUWOFHYBIR-IIXPRPJGSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|